C42H36N2O12Ru — CID 11848852
bis(2-[2-(1-benzoyl-5-methoxy-2-methylindol-3-yl)acetyl]oxyacetate);ruthenium(2+) (PubChem CID 11848852) has the molecular formula C42H36N2O12Ru and a molecular weight of 861.82 g/mol. Its IUPAC name is bis(2-[2-(1-benzoyl-5-methoxy-2-methylindol-3-yl)acetyl]oxyacetate);ruthenium(2+).
| Compound Name | bis(2-[2-(1-benzoyl-5-methoxy-2-methylindol-3-yl)acetyl]oxyacetate);ruthenium(2+) |
|---|---|
| PubChem CID | 11848852 |
| Molecular Formula | C42H36N2O12Ru |
| Molecular Weight | 861.82 g/mol |
| Exact Mass | 862.13 |
| IUPAC Name | bis(2-[2-(1-benzoyl-5-methoxy-2-methylindol-3-yl)acetyl]oxyacetate);ruthenium(2+) |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCC(=O)[O-])c(C)n2C(=O)c1ccccc1.COc1ccc2c(c1)c(CC(=O)OCC(=O)[O-])c(C)n2C(=O)c1ccccc1.[Ru+2] |
| InChI | InChI=1S/2C21H19NO6.Ru/c2*1-13-16(11-20(25)28-12-19(23)24)17-10-15(27-2)8-9-18(17)22(13)21(26)14-6-4-3-5-7-14;/h2*3-10H,11-12H2,1-2H3,(H,23,24);/q;;+2/p-2 |
| InChIKey | RPEIPWADTRKIAO-UHFFFAOYSA-L |
| XLogP | 2.96 |
| TPSA | 195.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |