C35H22N4O — CID 118488614
6-[5-(2,6-diphenylpyrimidin-4-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]indole (PubChem CID 118488614) has the molecular formula C35H22N4O and a molecular weight of 514.59 g/mol. Its IUPAC name is 6-[5-(2,6-diphenylpyrimidin-4-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]indole.
| Compound Name | 6-[5-(2,6-diphenylpyrimidin-4-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]indole |
|---|---|
| PubChem CID | 118488614 |
| Molecular Formula | C35H22N4O |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 6-[5-(2,6-diphenylpyrimidin-4-yl)-2-pyridinyl]-[1]benzofuro[2,3-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccc(-n4c5ccccc5c5c6ccccc6oc54)nc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H22N4O/c1-3-11-23(12-4-1)28-21-29(38-34(37-28)24-13-5-2-6-14-24)25-19-20-32(36-22-25)39-30-17-9-7-15-26(30)33-27-16-8-10-18-31(27)40-35(33)39/h1-22H |
| InChIKey | XYXGVLUWQBKSHT-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |