C48H26N10 — CID 118488710
5-[4-[6-[4-(1,10-phenanthrolin-5-yl)-1,3,5-triazin-2-yl]triphenylen-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline (PubChem CID 118488710) has the molecular formula C48H26N10 and a molecular weight of 742.81 g/mol. Its IUPAC name is 5-[4-[6-[4-(1,10-phenanthrolin-5-yl)-1,3,5-triazin-2-yl]triphenylen-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline.
| Compound Name | 5-[4-[6-[4-(1,10-phenanthrolin-5-yl)-1,3,5-triazin-2-yl]triphenylen-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 118488710 |
| Molecular Formula | C48H26N10 |
| Molecular Weight | 742.81 g/mol |
| Exact Mass | 742.23 |
| IUPAC Name | 5-[4-[6-[4-(1,10-phenanthrolin-5-yl)-1,3,5-triazin-2-yl]triphenylen-2-yl]-1,3,5-triazin-2-yl]-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)cc(-c1ncnc(-c3ccc4c(c3)c3ccccc3c3ccc(-c5ncnc(-c6cc7cccnc7c7ncccc67)n5)cc34)n1)c1cccnc12 |
| InChI | InChI=1S/C48H26N10/c1-2-10-32-31(9-1)33-15-13-29(45-53-25-55-47(57-45)39-21-27-7-3-17-49-41(27)43-35(39)11-5-19-51-43)24-38(33)34-16-14-30(23-37(32)34)46-54-26-56-48(58-46)40-22-28-8-4-18-50-42(28)44-36(40)12-6-20-52-44/h1-26H |
| InChIKey | QXORBDZTQLCDSR-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.81 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|