C14H24N2 — CID 118488829
2,4,6-trimethyl-8-propan-2-yl-1,2,3,4,4a,8a-hexahydroquinazoline (PubChem CID 118488829) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,4,6-trimethyl-8-propan-2-yl-1,2,3,4,4a,8a-hexahydroquinazoline.
| Compound Name | 2,4,6-trimethyl-8-propan-2-yl-1,2,3,4,4a,8a-hexahydroquinazoline |
|---|---|
| PubChem CID | 118488829 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2,4,6-trimethyl-8-propan-2-yl-1,2,3,4,4a,8a-hexahydroquinazoline |
| SMILES | CC1=CC2C(C)NC(C)NC2C(C(C)C)=C1 |
| InChI | InChI=1S/C14H24N2/c1-8(2)12-6-9(3)7-13-10(4)15-11(5)16-14(12)13/h6-8,10-11,13-16H,1-5H3 |
| InChIKey | PVGAFKDALLXTSJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |