About 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide
5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide (PubChem CID 118488872) has the molecular formula C18H16BrN3O3
and a molecular weight of 402.25 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide.
Molecular Properties
| Compound Name | 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide |
| PubChem CID | 118488872 |
| Molecular Formula | C18H16BrN3O3 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide |
| SMILES | C=CCN1C(=O)C(NNC(=O)c2cc(Br)ccc2O)c2ccccc21 |
| InChI | InChI=1S/C18H16BrN3O3/c1-2-9-22-14-6-4-3-5-12(14)16(18(22)25)20-21-17(24)13-10-11(19)7-8-15(13)23/h2-8,10,16,20,23H,1,9H2,(H,21,24) |
| InChIKey | RQVOFUNRDGPURN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide?
The IUPAC name of 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide (CID 118488872) is 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide.
What is the SMILES notation for 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide?
The canonical SMILES for 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide is C=CCN1C(=O)C(NNC(=O)c2cc(Br)ccc2O)c2ccccc21.
What is the InChIKey of 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide?
The InChIKey is RQVOFUNRDGPURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN3O3/c1-2-9-22-14-6-4-3-5-12(14)16(18(22)25)20-21-17(24)13-10-11(19)7-8-15(13)23/h2-8,10,16,20,23H,1,9H2,(H,21,24).
What are the key properties of 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide?
5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide has a molecular weight of 402.25 g/mol, XLogP of 2.66, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-hydroxy-N'-(2-oxo-1-prop-2-enyl-3H-indol-3-yl)benzohydrazide is sourced from PubChem (CID 118488872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).