About 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine
2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 118489345) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 118489345 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | CC(C)C1=CC2C=CN=CC2N1 |
| InChI | InChI=1S/C10H14N2/c1-7(2)9-5-8-3-4-11-6-10(8)12-9/h3-8,10,12H,1-2H3 |
| InChIKey | NKMAZULRWRVVOU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine (CID 118489345) is 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine is CC(C)C1=CC2C=CN=CC2N1.
What is the InChIKey of 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is NKMAZULRWRVVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-7(2)9-5-8-3-4-11-6-10(8)12-9/h3-8,10,12H,1-2H3.
What are the key properties of 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine?
2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 162.24 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-3a,7a-dihydro-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 118489345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).