C22H23ClFN3O — CID 118489647
1-(10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol (PubChem CID 118489647) has the molecular formula C22H23ClFN3O and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-(10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol.
| Compound Name | 1-(10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 118489647 |
| Molecular Formula | C22H23ClFN3O |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-(10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-2-pyridin-3-ylpropan-2-ol |
| SMILES | CC(O)(Cn1c2c(c3cc(Cl)cc(F)c31)C1CCCN1CC2)c1cccnc1 |
| InChI | InChI=1S/C22H23ClFN3O/c1-22(28,14-4-2-7-25-12-14)13-27-19-6-9-26-8-3-5-18(26)20(19)16-10-15(23)11-17(24)21(16)27/h2,4,7,10-12,18,28H,3,5-6,8-9,13H2,1H3 |
| InChIKey | DAQOKXJFPNPZBW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|