C20H23N5O — CID 118489656
2-(14-methyl-6,10,12,13-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-pyridin-3-ylethanol (PubChem CID 118489656) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 2-(14-methyl-6,10,12,13-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-pyridin-3-ylethanol.
| Compound Name | 2-(14-methyl-6,10,12,13-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 118489656 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-(14-methyl-6,10,12,13-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl)-1-pyridin-3-ylethanol |
| SMILES | Cc1cc2c3c(n(CC(O)c4cccnc4)c2nn1)CCN1CCCC31 |
| InChI | InChI=1S/C20H23N5O/c1-13-10-15-19-16-5-3-8-24(16)9-6-17(19)25(20(15)23-22-13)12-18(26)14-4-2-7-21-11-14/h2,4,7,10-11,16,18,26H,3,5-6,8-9,12H2,1H3 |
| InChIKey | RVJGVUYRBJRWRZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |