C22H23F2N3O — CID 118489665
2-(9,11-difluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol (PubChem CID 118489665) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-(9,11-difluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(9,11-difluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 118489665 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-(9,11-difluoro-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
| SMILES | Cc1c(F)cc2c(c1F)c1c(n2CC(O)c2ccncc2)CCN2CCCC12 |
| InChI | InChI=1S/C22H23F2N3O/c1-13-15(23)11-18-21(22(13)24)20-16-3-2-9-26(16)10-6-17(20)27(18)12-19(28)14-4-7-25-8-5-14/h4-5,7-8,11,16,19,28H,2-3,6,9-10,12H2,1H3 |
| InChIKey | NIQXASMBPFZQSA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |