C24H28FN3O — CID 118489671
2-(6-fluoro-6,8,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol (PubChem CID 118489671) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-(6-fluoro-6,8,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol.
| Compound Name | 2-(6-fluoro-6,8,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 118489671 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-(6-fluoro-6,8,10-trimethyl-2,3,5,11c-tetrahydro-1H-indolizino[7,8-b]indol-7-yl)-1-pyridin-4-ylethanol |
| SMILES | Cc1cc(C)c2c(c1)c1c(n2CC(O)c2ccncc2)C(C)(F)CN2CCCC12 |
| InChI | InChI=1S/C24H28FN3O/c1-15-11-16(2)22-18(12-15)21-19-5-4-10-27(19)14-24(3,25)23(21)28(22)13-20(29)17-6-8-26-9-7-17/h6-9,11-12,19-20,29H,4-5,10,13-14H2,1-3H3 |
| InChIKey | UHVNKGOOGYSXBN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |