C29H37N3O — CID 118489680
7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole (PubChem CID 118489680) has the molecular formula C29H37N3O and a molecular weight of 443.64 g/mol. Its IUPAC name is 7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole.
| Compound Name | 7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
|---|---|
| PubChem CID | 118489680 |
| Molecular Formula | C29H37N3O |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 7-[2-(cyclobutylmethoxy)-2-pyridin-3-ylpropyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
| SMILES | Cc1cc(C)c2c(c1)c1c(n2CC(C)(OCC2CCC2)c2cccnc2)CCN2CCCC12 |
| InChI | InChI=1S/C29H37N3O/c1-20-15-21(2)28-24(16-20)27-25-10-6-13-31(25)14-11-26(27)32(28)19-29(3,23-9-5-12-30-17-23)33-18-22-7-4-8-22/h5,9,12,15-17,22,25H,4,6-8,10-11,13-14,18-19H2,1-3H3 |
| InChIKey | QNJINHBCLWTEFT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|