About N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide
N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide (PubChem CID 118489711) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide |
| PubChem CID | 118489711 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide |
| SMILES | C=C/C=C/N=C/N(C)CCC(C)N |
| InChI | InChI=1S/C10H19N3/c1-4-5-7-12-9-13(3)8-6-10(2)11/h4-5,7,9-10H,1,6,8,11H2,2-3H3/b7-5+,12-9+ |
| InChIKey | BRILRSVADHERMD-SWCFZJNMSA-N |
| XLogP | 1.38 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide?
The IUPAC name of N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide (CID 118489711) is N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide.
What is the SMILES notation for N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide?
The canonical SMILES for N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide is C=C/C=C/N=C/N(C)CCC(C)N.
What is the InChIKey of N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide?
The InChIKey is BRILRSVADHERMD-SWCFZJNMSA-N. The full InChI is InChI=1S/C10H19N3/c1-4-5-7-12-9-13(3)8-6-10(2)11/h4-5,7,9-10H,1,6,8,11H2,2-3H3/b7-5+,12-9+.
What are the key properties of N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide?
N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide has a molecular weight of 181.28 g/mol, XLogP of 1.38, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminobutyl)-N'-[(1E)-buta-1,3-dienyl]-N-methylmethanimidamide is sourced from PubChem (CID 118489711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).