About 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine
1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine (PubChem CID 118489737) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine.
Molecular Properties
| Compound Name | 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine |
| PubChem CID | 118489737 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine |
| SMILES | C/C=C/N/C(=N\C)N(C)CCC(C)N |
| InChI | InChI=1S/C10H22N4/c1-5-7-13-10(12-3)14(4)8-6-9(2)11/h5,7,9H,6,8,11H2,1-4H3,(H,12,13)/b7-5+ |
| InChIKey | ITJYQJQYXFCHSN-FNORWQNLSA-N |
| XLogP | 0.76 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine?
The IUPAC name of 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine (CID 118489737) is 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine.
What is the SMILES notation for 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine?
The canonical SMILES for 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine is C/C=C/N/C(=N\C)N(C)CCC(C)N.
What is the InChIKey of 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine?
The InChIKey is ITJYQJQYXFCHSN-FNORWQNLSA-N. The full InChI is InChI=1S/C10H22N4/c1-5-7-13-10(12-3)14(4)8-6-9(2)11/h5,7,9H,6,8,11H2,1-4H3,(H,12,13)/b7-5+.
What are the key properties of 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine?
1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine has a molecular weight of 198.31 g/mol, XLogP of 0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminobutyl)-1,2-dimethyl-3-[(E)-prop-1-enyl]guanidine is sourced from PubChem (CID 118489737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).