About (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide
(Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide (PubChem CID 118490164) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide |
| PubChem CID | 118490164 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide |
| SMILES | CCCN(C)/C=N/C=C(/C)C(=O)NC |
| InChI | InChI=1S/C10H19N3O/c1-5-6-13(4)8-12-7-9(2)10(14)11-3/h7-8H,5-6H2,1-4H3,(H,11,14)/b9-7-,12-8+ |
| InChIKey | RNLGUGMNOMYNFY-ZUQSVMQASA-N |
| XLogP | 1.01 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide?
The IUPAC name of (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide (CID 118490164) is (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide.
What is the SMILES notation for (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide?
The canonical SMILES for (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide is CCCN(C)/C=N/C=C(/C)C(=O)NC.
What is the InChIKey of (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide?
The InChIKey is RNLGUGMNOMYNFY-ZUQSVMQASA-N. The full InChI is InChI=1S/C10H19N3O/c1-5-6-13(4)8-12-7-9(2)10(14)11-3/h7-8H,5-6H2,1-4H3,(H,11,14)/b9-7-,12-8+.
What are the key properties of (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide?
(Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide has a molecular weight of 197.28 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2-dimethyl-3-[[methyl(propyl)amino]methylideneamino]prop-2-enamide is sourced from PubChem (CID 118490164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).