C11H21N3 — CID 118490254
1-ethyl-1,3,3-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]guanidine (PubChem CID 118490254) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-ethyl-1,3,3-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]guanidine.
| Compound Name | 1-ethyl-1,3,3-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]guanidine |
|---|---|
| PubChem CID | 118490254 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-ethyl-1,3,3-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]guanidine |
| SMILES | C/C=C/C=C/N=C(\N(C)C)N(C)CC |
| InChI | InChI=1S/C11H21N3/c1-6-8-9-10-12-11(13(3)4)14(5)7-2/h6,8-10H,7H2,1-5H3/b8-6+,10-9+,12-11+ |
| InChIKey | ZISZBGVPNHUVNH-XDNOHYQPSA-N |
| XLogP | 1.95 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|