About (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate
(6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate (PubChem CID 118490612) has the molecular formula C23H18F3NO5S
and a molecular weight of 477.46 g/mol. Its IUPAC name is (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 118490612 |
| Molecular Formula | C23H18F3NO5S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C23H18F3NO5S/c1-22(2,3)18-12-11-17-19-15(18)5-4-6-16(19)20(28)27(21(17)29)32-33(30,31)14-9-7-13(8-10-14)23(24,25)26/h4-12H,1-3H3 |
| InChIKey | JQXQMIPTQZKDBQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate?
The IUPAC name of (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate (CID 118490612) is (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate is CC(C)(C)c1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1ccc(C(F)(F)F)cc1)C2=O.
What is the InChIKey of (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate?
The InChIKey is JQXQMIPTQZKDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F3NO5S/c1-22(2,3)18-12-11-17-19-15(18)5-4-6-16(19)20(28)27(21(17)29)32-33(30,31)14-9-7-13(8-10-14)23(24,25)26/h4-12H,1-3H3.
What are the key properties of (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate?
(6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate has a molecular weight of 477.46 g/mol, XLogP of 5.07, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-tert-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 118490612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).