About (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one
(E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one (PubChem CID 118491249) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one |
| PubChem CID | 118491249 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one |
| SMILES | CCOc1c(OC)cc(/C=C/C(=O)c2ccncc2)cc1OC |
| InChI | InChI=1S/C18H19NO4/c1-4-23-18-16(21-2)11-13(12-17(18)22-3)5-6-15(20)14-7-9-19-10-8-14/h5-12H,4H2,1-3H3/b6-5+ |
| InChIKey | DRSHJEXKZDUEMK-AATRIKPKSA-N |
| XLogP | 3.39 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one?
The IUPAC name of (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one (CID 118491249) is (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one.
What is the SMILES notation for (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one?
The canonical SMILES for (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one is CCOc1c(OC)cc(/C=C/C(=O)c2ccncc2)cc1OC.
What is the InChIKey of (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one?
The InChIKey is DRSHJEXKZDUEMK-AATRIKPKSA-N. The full InChI is InChI=1S/C18H19NO4/c1-4-23-18-16(21-2)11-13(12-17(18)22-3)5-6-15(20)14-7-9-19-10-8-14/h5-12H,4H2,1-3H3/b6-5+.
What are the key properties of (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one?
(E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one has a molecular weight of 313.35 g/mol, XLogP of 3.39, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-ethoxy-3,5-dimethoxyphenyl)-1-pyridin-4-ylprop-2-en-1-one is sourced from PubChem (CID 118491249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).