C22H22N4O12 — CID 118491581
4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid (PubChem CID 118491581) has the molecular formula C22H22N4O12 and a molecular weight of 534.43 g/mol. Its IUPAC name is 4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118491581 |
| Molecular Formula | C22H22N4O12 |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 4-[[3-carboxypropanoyl-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-[3-(2,5-dioxopyrrol-1-yl)propanoyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C(=O)CCN1C(=O)C=CC1=O)N(C(=O)CCC(=O)O)C(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C22H22N4O12/c27-13-1-2-14(28)23(13)11-9-19(33)25(17(31)5-7-21(35)36)26(18(32)6-8-22(37)38)20(34)10-12-24-15(29)3-4-16(24)30/h1-4H,5-12H2,(H,35,36)(H,37,38) |
| InChIKey | KCRPVOJRKCPFRI-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 224.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|