About 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine
6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 118491774) has the molecular formula C8H9FN2
and a molecular weight of 152.17 g/mol. Its IUPAC name is 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 118491774 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CC1=CC2C(N1)C=C(C=N2)F |
| InChI | InChI=1S/C8H9FN2/c1-5-2-7-8(11-5)3-6(9)4-10-7/h2-4,7-8,11H,1H3 |
| InChIKey | LMEXVSQGIYXBQY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 24.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 265 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (CID 118491774) is 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine is CC1=CC2C(N1)C=C(C=N2)F.
What is the InChIKey of 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is LMEXVSQGIYXBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2/c1-5-2-7-8(11-5)3-6(9)4-10-7/h2-4,7-8,11H,1H3.
What are the key properties of 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 152.17 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 118491774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).