About 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine
2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 118491776) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
Analyze 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine (CID 118491776) is 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine is CC1=CC2N=C(C)C=CC2N1.
What is the InChIKey of 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is HEXZMSJYGLRARZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-6-3-4-8-9(10-6)5-7(2)11-8/h3-5,8-9,11H,1-2H3.
What are the key properties of 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine?
2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 148.21 g/mol, XLogP of 1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3a,7a-dihydro-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 118491776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).