C8H12ClN3O2S — CID 118491777
5-(chloromethylsulfonyl)-3-methyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 118491777) has the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. Its IUPAC name is 5-(chloromethylsulfonyl)-3-methyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-(chloromethylsulfonyl)-3-methyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118491777 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 5-(chloromethylsulfonyl)-3-methyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | Cc1[nH]nc2c1CN(S(=O)(=O)CCl)CC2 |
| InChI | InChI=1S/C8H12ClN3O2S/c1-6-7-4-12(15(13,14)5-9)3-2-8(7)11-10-6/h2-5H2,1H3,(H,10,11) |
| InChIKey | YIJNBRAWKYRMPN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|