C23H33N5O4S — CID 118491889
4-[5-[5-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine (PubChem CID 118491889) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is 4-[5-[5-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-[5-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 118491889 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 4-[5-[5-[4-[(E)-N-ethoxy-C-ethylcarbonimidoyl]phenoxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
| SMILES | CCO/N=C(\CC)c1ccc(OCCCCCN2CCN(c3ccnc(N)c3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C23H33N5O4S/c1-3-22(26-32-4-2)19-8-10-21(11-9-19)31-17-7-5-6-14-27-15-16-28(33(27,29)30)20-12-13-25-23(24)18-20/h8-13,18H,3-7,14-17H2,1-2H3,(H2,24,25)/b26-22+ |
| InChIKey | CTRPXHHYGOXZRW-XTCLZLMSSA-N |
| XLogP | 3.43 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|