C21H27N5O4S — CID 118491903
4-[5-[5-[(3-ethyl-1,2-benzoxazol-6-yl)oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine (PubChem CID 118491903) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is 4-[5-[5-[(3-ethyl-1,2-benzoxazol-6-yl)oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-[5-[(3-ethyl-1,2-benzoxazol-6-yl)oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 118491903 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[5-[5-[(3-ethyl-1,2-benzoxazol-6-yl)oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
| SMILES | CCc1noc2cc(OCCCCCN3CCN(c4ccnc(N)c4)S3(=O)=O)ccc12 |
| InChI | InChI=1S/C21H27N5O4S/c1-2-19-18-7-6-17(15-20(18)30-24-19)29-13-5-3-4-10-25-11-12-26(31(25,27)28)16-8-9-23-21(22)14-16/h6-9,14-15H,2-5,10-13H2,1H3,(H2,22,23) |
| InChIKey | BUQKLCVMWVGGAS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|