About 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine
1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine (PubChem CID 118492052) has the molecular formula C13H30N2O
and a molecular weight of 230.40 g/mol. Its IUPAC name is 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine |
| PubChem CID | 118492052 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine |
| SMILES | CCC(C)(N)C(C)COC(C)(C)CC(C)N |
| InChI | InChI=1S/C13H30N2O/c1-7-13(6,15)10(2)9-16-12(4,5)8-11(3)14/h10-11H,7-9,14-15H2,1-6H3 |
| InChIKey | KDOWRJPYMUKUEC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine?
The IUPAC name of 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine (CID 118492052) is 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine.
What is the SMILES notation for 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine?
The canonical SMILES for 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine is CCC(C)(N)C(C)COC(C)(C)CC(C)N.
What is the InChIKey of 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine?
The InChIKey is KDOWRJPYMUKUEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O/c1-7-13(6,15)10(2)9-16-12(4,5)8-11(3)14/h10-11H,7-9,14-15H2,1-6H3.
What are the key properties of 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine?
1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine has a molecular weight of 230.40 g/mol, XLogP of 2.28, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-2-methylpentan-2-yl)oxy-2,3-dimethylpentan-3-amine is sourced from PubChem (CID 118492052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).