About (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine (PubChem CID 118492067) has the molecular formula C12H11F6N
and a molecular weight of 283.22 g/mol. Its IUPAC name is (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine |
| PubChem CID | 118492067 |
| Molecular Formula | C12H11F6N |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine |
| SMILES | C=C[C@H](NC)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6N/c1-3-10(19-2)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18/h3-6,10,19H,1H2,2H3/t10-/m0/s1 |
| InChIKey | DEVNGRJKOTVTPH-JTQLQIEISA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine?
The IUPAC name of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine (CID 118492067) is (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine.
What is the SMILES notation for (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine?
The canonical SMILES for (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine is C=C[C@H](NC)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine?
The InChIKey is DEVNGRJKOTVTPH-JTQLQIEISA-N. The full InChI is InChI=1S/C12H11F6N/c1-3-10(19-2)7-4-8(11(13,14)15)6-9(5-7)12(16,17)18/h3-6,10,19H,1H2,2H3/t10-/m0/s1.
What are the key properties of (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine?
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine has a molecular weight of 283.22 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[3,5-bis(trifluoromethyl)phenyl]-N-methylprop-2-en-1-amine is sourced from PubChem (CID 118492067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).