C20H27N9O3S — CID 118492152
4-[5-[5-[[5-(2-ethyltetrazol-5-yl)-2-pyridinyl]oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine (PubChem CID 118492152) has the molecular formula C20H27N9O3S and a molecular weight of 473.56 g/mol. Its IUPAC name is 4-[5-[5-[[5-(2-ethyltetrazol-5-yl)-2-pyridinyl]oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-[5-[[5-(2-ethyltetrazol-5-yl)-2-pyridinyl]oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 118492152 |
| Molecular Formula | C20H27N9O3S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 4-[5-[5-[[5-(2-ethyltetrazol-5-yl)-2-pyridinyl]oxy]pentyl]-1,1-dioxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
| SMILES | CCn1nnc(-c2ccc(OCCCCCN3CCN(c4ccnc(N)c4)S3(=O)=O)nc2)n1 |
| InChI | InChI=1S/C20H27N9O3S/c1-2-29-25-20(24-26-29)16-6-7-19(23-15-16)32-13-5-3-4-10-27-11-12-28(33(27,30)31)17-8-9-22-18(21)14-17/h6-9,14-15H,2-5,10-13H2,1H3,(H2,21,22) |
| InChIKey | NNJAIXROMPTBNG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|