C17H16ClIN2O3 — CID 118492385
2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]butanoic acid (PubChem CID 118492385) has the molecular formula C17H16ClIN2O3 and a molecular weight of 458.68 g/mol. Its IUPAC name is 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]butanoic acid.
| Compound Name | 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 118492385 |
| Molecular Formula | C17H16ClIN2O3 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1CNC(=O)c2cc(-c3cccc(Cl)c3)c(I)n21 |
| InChI | InChI=1S/C17H16ClIN2O3/c1-2-11(17(23)24)14-8-20-16(22)13-7-12(15(19)21(13)14)9-4-3-5-10(18)6-9/h3-7,11,14H,2,8H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | JHUWZNJRXSOZQL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|