C5H9F3N4O2 — CID 118493031
(2S,3R)-2-amino-3-(diaminomethylideneamino)-4,4,4-trifluorobutanoic acid (PubChem CID 118493031) has the molecular formula C5H9F3N4O2 and a molecular weight of 214.15 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-(diaminomethylideneamino)-4,4,4-trifluorobutanoic acid.
| Compound Name | (2S,3R)-2-amino-3-(diaminomethylideneamino)-4,4,4-trifluorobutanoic acid |
|---|---|
| PubChem CID | 118493031 |
| Molecular Formula | C5H9F3N4O2 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | (2S,3R)-2-amino-3-(diaminomethylideneamino)-4,4,4-trifluorobutanoic acid |
| SMILES | NC(N)=N[C@H]([C@H](N)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C5H9F3N4O2/c6-5(7,8)2(12-4(10)11)1(9)3(13)14/h1-2H,9H2,(H,13,14)(H4,10,11,12)/t1-,2+/m0/s1 |
| InChIKey | XQWPQSDMNOTRJQ-NHYDCYSISA-N |
| XLogP | -1.40 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|