C38H42N2O2 — CID 118493243
[4-[[4-[[4-(diethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 118493243) has the molecular formula C38H42N2O2 and a molecular weight of 558.77 g/mol. Its IUPAC name is [4-[[4-[[4-(diethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-[[4-[[4-(diethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118493243 |
| Molecular Formula | C38H42N2O2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | [4-[[4-[[4-(diethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(Nc2ccc(C(c3ccc(N(CC)CC)cc3)=c3ccc(=C)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C38H42N2O2/c1-6-40(7-2)31-20-16-29(17-21-31)37(28-14-12-27(5)13-15-28)35-24-25-36(34-11-9-8-10-33(34)35)39-30-18-22-32(23-19-30)42-38(41)26(3)4/h8-17,20-21,24-25,30,32,39H,3,5-7,18-19,22-23H2,1-2,4H3 |
| InChIKey | VYQIIVMVCOWPRP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|