C36H38N2O2 — CID 118493244
[4-[[4-[[4-(dimethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 118493244) has the molecular formula C36H38N2O2 and a molecular weight of 530.71 g/mol. Its IUPAC name is [4-[[4-[[4-(dimethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [4-[[4-[[4-(dimethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118493244 |
| Molecular Formula | C36H38N2O2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | [4-[[4-[[4-(dimethylamino)phenyl]-(4-methylidenecyclohexa-2,5-dien-1-ylidene)methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(Nc2ccc(C(c3ccc(N(C)C)cc3)=c3ccc(=C)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C36H38N2O2/c1-24(2)36(39)40-30-20-16-28(17-21-30)37-34-23-22-33(31-8-6-7-9-32(31)34)35(26-12-10-25(3)11-13-26)27-14-18-29(19-15-27)38(4)5/h6-15,18-19,22-23,28,30,37H,1,3,16-17,20-21H2,2,4-5H3 |
| InChIKey | KHQQPVNAPUISIP-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|