C11H14ClNO — CID 118493266
6-chloro-2-(3,3-dimethylbut-1-en-2-yl)pyridin-3-ol (PubChem CID 118493266) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 6-chloro-2-(3,3-dimethylbut-1-en-2-yl)pyridin-3-ol.
| Compound Name | 6-chloro-2-(3,3-dimethylbut-1-en-2-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 118493266 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 6-chloro-2-(3,3-dimethylbut-1-en-2-yl)pyridin-3-ol |
| SMILES | C=C(c1nc(Cl)ccc1O)C(C)(C)C |
| InChI | InChI=1S/C11H14ClNO/c1-7(11(2,3)4)10-8(14)5-6-9(12)13-10/h5-6,14H,1H2,2-4H3 |
| InChIKey | PGSOXMCCLYJISF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|