C8H12N2O — CID 118493356
3-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole (PubChem CID 118493356) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole.
| Compound Name | 3-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
|---|---|
| PubChem CID | 118493356 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-ethyl-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole |
| SMILES | CCc1n[nH]c2c1COCC2 |
| InChI | InChI=1S/C8H12N2O/c1-2-7-6-5-11-4-3-8(6)10-9-7/h2-5H2,1H3,(H,9,10) |
| InChIKey | ORXPJKBWHUUEIR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |