About 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one
9,11-dimethylpyrido[3,2-a]phenoxazin-5-one (PubChem CID 11849336) has the molecular formula C17H12N2O2
and a molecular weight of 276.29 g/mol. Its IUPAC name is 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one.
Molecular Properties
| Compound Name | 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one |
| PubChem CID | 11849336 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one |
| SMILES | Cc1cc(C)c2nc3c4cccnc4c(=O)cc-3oc2c1 |
| InChI | InChI=1S/C17H12N2O2/c1-9-6-10(2)15-13(7-9)21-14-8-12(20)16-11(17(14)19-15)4-3-5-18-16/h3-8H,1-2H3 |
| InChIKey | NWZSHWHYTOKXKE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one?
The IUPAC name of 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one (CID 11849336) is 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one.
What is the SMILES notation for 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one?
The canonical SMILES for 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one is Cc1cc(C)c2nc3c4cccnc4c(=O)cc-3oc2c1.
What is the InChIKey of 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one?
The InChIKey is NWZSHWHYTOKXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2/c1-9-6-10(2)15-13(7-9)21-14-8-12(20)16-11(17(14)19-15)4-3-5-18-16/h3-8H,1-2H3.
What are the key properties of 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one?
9,11-dimethylpyrido[3,2-a]phenoxazin-5-one has a molecular weight of 276.29 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9,11-dimethylpyrido[3,2-a]phenoxazin-5-one is sourced from PubChem (CID 11849336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).