C28H23F2N7O3 — CID 118494000
(E)-2-[3-[4-amino-3-[2-fluoro-4-(3-fluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-hydroxybut-2-enenitrile (PubChem CID 118494000) has the molecular formula C28H23F2N7O3 and a molecular weight of 543.53 g/mol. Its IUPAC name is (E)-2-[3-[4-amino-3-[2-fluoro-4-(3-fluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-hydroxybut-2-enenitrile.
| Compound Name | (E)-2-[3-[4-amino-3-[2-fluoro-4-(3-fluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 118494000 |
| Molecular Formula | C28H23F2N7O3 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | (E)-2-[3-[4-amino-3-[2-fluoro-4-(3-fluorobenzoyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonyl]-3-hydroxybut-2-enenitrile |
| SMILES | C/C(O)=C(/C#N)C(=O)N1CCCC(n2nc(-c3ccc(C(=O)c4cccc(F)c4)cc3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C28H23F2N7O3/c1-15(38)21(12-31)28(40)36-9-3-6-19(13-36)37-27-23(26(32)33-14-34-27)24(35-37)20-8-7-17(11-22(20)30)25(39)16-4-2-5-18(29)10-16/h2,4-5,7-8,10-11,14,19,38H,3,6,9,13H2,1H3,(H2,32,33,34)/b21-15+ |
| InChIKey | XEYOPSLNAJLQJO-RCCKNPSSSA-N |
| XLogP | 4.10 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|