C27H19F5N6O3 — CID 118494273
1-[4-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]pyrrole-2,5-dione (PubChem CID 118494273) has the molecular formula C27H19F5N6O3 and a molecular weight of 570.48 g/mol. Its IUPAC name is 1-[4-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118494273 |
| Molecular Formula | C27H19F5N6O3 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 1-[4-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]cyclohexyl]pyrrole-2,5-dione |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3c(F)c(F)cc(F)c3F)cc1F)nn2C1CCC(N2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C27H19F5N6O3/c28-16-9-14(41-25-22(31)17(29)10-18(30)23(25)32)5-6-15(16)24-21-26(33)34-11-35-27(21)38(36-24)13-3-1-12(2-4-13)37-19(39)7-8-20(37)40/h5-13H,1-4H2,(H2,33,34,35) |
| InChIKey | FRORLEGKKRFHPO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|