C25H19ClF5N5O3 — CID 118494349
1-[(3R)-3-[4-amino-5-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-2-chloro-3-hydroxypropan-1-one (PubChem CID 118494349) has the molecular formula C25H19ClF5N5O3 and a molecular weight of 567.90 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-5-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-2-chloro-3-hydroxypropan-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-5-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-2-chloro-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 118494349 |
| Molecular Formula | C25H19ClF5N5O3 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | 1-[(3R)-3-[4-amino-5-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-2-chloro-3-hydroxypropan-1-one |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3c(F)c(F)cc(F)c3F)cc1F)cn2[C@@H]1CCN(C(=O)C(Cl)CO)C1 |
| InChI | InChI=1S/C25H19ClF5N5O3/c26-15(9-37)25(38)35-4-3-11(7-35)36-8-14(19-23(32)33-10-34-24(19)36)13-2-1-12(5-16(13)27)39-22-20(30)17(28)6-18(29)21(22)31/h1-2,5-6,8,10-11,15,37H,3-4,7,9H2,(H2,32,33,34)/t11-,15?/m1/s1 |
| InChIKey | IFEIJXBQRKHXDX-ZRKZCGFPSA-N |
| XLogP | 4.54 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|