C25H16F5N7O3 — CID 118494395
[(3R)-3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-(1,3-oxazol-2-yl)methanone (PubChem CID 118494395) has the molecular formula C25H16F5N7O3 and a molecular weight of 557.44 g/mol. Its IUPAC name is [(3R)-3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-(1,3-oxazol-2-yl)methanone.
| Compound Name | [(3R)-3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-(1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 118494395 |
| Molecular Formula | C25H16F5N7O3 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [(3R)-3-[4-amino-3-[2-fluoro-4-(2,3,5,6-tetrafluorophenoxy)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pyrrolidin-1-yl]-(1,3-oxazol-2-yl)methanone |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3c(F)c(F)cc(F)c3F)cc1F)nn2[C@@H]1CCN(C(=O)c2ncco2)C1 |
| InChI | InChI=1S/C25H16F5N7O3/c26-14-7-12(40-21-18(29)15(27)8-16(28)19(21)30)1-2-13(14)20-17-22(31)33-10-34-23(17)37(35-20)11-3-5-36(9-11)25(38)24-32-4-6-39-24/h1-2,4,6-8,10-11H,3,5,9H2,(H2,31,33,34)/t11-/m1/s1 |
| InChIKey | WBAHZPZPDHYBCL-LLVKDONJSA-N |
| XLogP | 4.64 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|