About tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate
tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate (PubChem CID 118494592) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate |
| PubChem CID | 118494592 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)CC/C=C/C#N |
| InChI | InChI=1S/C12H20N2O3/c1-12(2,3)17-11(16)14-10(9-15)7-5-4-6-8-13/h4,6,10,15H,5,7,9H2,1-3H3,(H,14,16)/b6-4+/t10-/m0/s1 |
| InChIKey | YSZJVZFRVUUMQS-RWCYGVJQSA-N |
| XLogP | 1.73 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate (CID 118494592) is tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate is CC(C)(C)OC(=O)N[C@H](CO)CC/C=C/C#N.
What is the InChIKey of tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate?
The InChIKey is YSZJVZFRVUUMQS-RWCYGVJQSA-N. The full InChI is InChI=1S/C12H20N2O3/c1-12(2,3)17-11(16)14-10(9-15)7-5-4-6-8-13/h4,6,10,15H,5,7,9H2,1-3H3,(H,14,16)/b6-4+/t10-/m0/s1.
What are the key properties of tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate?
tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate has a molecular weight of 240.30 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E,2S)-6-cyano-1-hydroxyhex-5-en-2-yl]carbamate is sourced from PubChem (CID 118494592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).