C11H15N — CID 118494749
(3Z,5Z,7E)-N-ethenylnona-3,5,7-trien-2-imine (PubChem CID 118494749) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (3Z,5Z,7E)-N-ethenylnona-3,5,7-trien-2-imine.
| Compound Name | (3Z,5Z,7E)-N-ethenylnona-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 118494749 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3Z,5Z,7E)-N-ethenylnona-3,5,7-trien-2-imine |
| SMILES | C=C/N=C(C)/C=C\C=C/C=C/C |
| InChI | InChI=1S/C11H15N/c1-4-6-7-8-9-10-11(3)12-5-2/h4-10H,2H2,1,3H3/b6-4+,8-7-,10-9-,12-11+ |
| InChIKey | ZTFXVGBBHQVFPI-MEJZMCHNSA-N |
| XLogP | 3.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|