C20H31NO2 — CID 118496522
(3S,7R,8R,9S)-3-amino-7-benzyl-8-butyl-9-methyloxonan-2-one (PubChem CID 118496522) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (3S,7R,8R,9S)-3-amino-7-benzyl-8-butyl-9-methyloxonan-2-one.
| Compound Name | (3S,7R,8R,9S)-3-amino-7-benzyl-8-butyl-9-methyloxonan-2-one |
|---|---|
| PubChem CID | 118496522 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (3S,7R,8R,9S)-3-amino-7-benzyl-8-butyl-9-methyloxonan-2-one |
| SMILES | CCCC[C@@H]1[C@@H](Cc2ccccc2)CCC[C@H](N)C(=O)O[C@H]1C |
| InChI | InChI=1S/C20H31NO2/c1-3-4-12-18-15(2)23-20(22)19(21)13-8-11-17(18)14-16-9-6-5-7-10-16/h5-7,9-10,15,17-19H,3-4,8,11-14,21H2,1-2H3/t15-,17+,18-,19-/m0/s1 |
| InChIKey | RVSNZOROESXPAT-NQYYFHDYSA-N |
| XLogP | 4.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |