About cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene
cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene (PubChem CID 118496568) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene |
| PubChem CID | 118496568 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene |
| SMILES | Cc1ccccc1.N[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C7H8.C3H6FN/c1-7-5-3-2-4-6-7;4-2-1-3(2)5/h2-6H,1H3;2-3H,1,5H2/t;2-,3+/m.0/s1 |
| InChIKey | SXURWOVXPRHUPQ-LMLSDSMGSA-N |
| XLogP | 2.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene?
The IUPAC name of cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene (CID 118496568) is cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene.
What is the SMILES notation for cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene?
The canonical SMILES for cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene is Cc1ccccc1.N[C@@H]1C[C@@H]1F.
What is the InChIKey of cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene?
The InChIKey is SXURWOVXPRHUPQ-LMLSDSMGSA-N. The full InChI is InChI=1S/C7H8.C3H6FN/c1-7-5-3-2-4-6-7;4-2-1-3(2)5/h2-6H,1H3;2-3H,1,5H2/t;2-,3+/m.0/s1.
What are the key properties of cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene?
cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene has a molecular weight of 167.23 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-fluorocyclopropan-1-amine;toluene is sourced from PubChem (CID 118496568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).