About [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate
[1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate (PubChem CID 118496697) has the molecular formula C17H32N2O2
and a molecular weight of 296.45 g/mol. Its IUPAC name is [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate.
Molecular Properties
| Compound Name | [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate |
| PubChem CID | 118496697 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1N(C(C)C)C=CN1C(C)C |
| InChI | InChI=1S/C17H32N2O2/c1-6-7-8-9-10-11-16(20)21-17-18(14(2)3)12-13-19(17)15(4)5/h12-15,17H,6-11H2,1-5H3 |
| InChIKey | MAXFGHSAXLHXJR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate?
The IUPAC name of [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate (CID 118496697) is [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate.
What is the SMILES notation for [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate?
The canonical SMILES for [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate is CCCCCCCC(=O)OC1N(C(C)C)C=CN1C(C)C.
What is the InChIKey of [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate?
The InChIKey is MAXFGHSAXLHXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O2/c1-6-7-8-9-10-11-16(20)21-17-18(14(2)3)12-13-19(17)15(4)5/h12-15,17H,6-11H2,1-5H3.
What are the key properties of [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate?
[1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate has a molecular weight of 296.45 g/mol, XLogP of 4.08, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-di(propan-2-yl)-2H-imidazol-2-yl] octanoate is sourced from PubChem (CID 118496697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).