C24H20ClFN5O6P — CID 118497020
2-[[5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carbonyl]amino]ethyl dihydrogen phosphate (PubChem CID 118497020) has the molecular formula C24H20ClFN5O6P and a molecular weight of 559.88 g/mol. Its IUPAC name is 2-[[5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carbonyl]amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[[5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carbonyl]amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 118497020 |
| Molecular Formula | C24H20ClFN5O6P |
| Molecular Weight | 559.88 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 2-[[5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carbonyl]amino]ethyl dihydrogen phosphate |
| SMILES | O=C(NCCOP(=O)(O)O)c1cc(NC(=O)c2cc(-c3ccccn3)c(F)cc2Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H20ClFN5O6P/c25-18-13-19(26)17(20-8-4-5-9-27-20)12-16(18)23(32)29-22-14-21(24(33)28-10-11-37-38(34,35)36)30-31(22)15-6-2-1-3-7-15/h1-9,12-14H,10-11H2,(H,28,33)(H,29,32)(H2,34,35,36) |
| InChIKey | QNSCVMKDBCGFJJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 155.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.88 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|