C30H33N3O5S — CID 11849756
(2R)-N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 11849756) has the molecular formula C30H33N3O5S and a molecular weight of 547.68 g/mol. Its IUPAC name is (2R)-N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11849756 |
| Molecular Formula | C30H33N3O5S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | (2R)-N-[3,4-dioxo-1-phenyl-4-(2-phenylethylamino)butan-2-yl]-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)NC(Cc2ccccc2)C(=O)C(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H33N3O5S/c1-22-14-16-25(17-15-22)39(37,38)33-20-8-13-27(33)29(35)32-26(21-24-11-6-3-7-12-24)28(34)30(36)31-19-18-23-9-4-2-5-10-23/h2-7,9-12,14-17,26-27H,8,13,18-21H2,1H3,(H,31,36)(H,32,35)/t26?,27-/m1/s1 |
| InChIKey | ZVCMWRZQJKHAIK-SSYAZFEXSA-N |
| XLogP | 2.80 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|