C23H17Cl2N3O6S2 — CID 118497675
N-[3,4-bis[benzenesulfonyl(chloro)amino]phenyl]furan-2-carboxamide (PubChem CID 118497675) has the molecular formula C23H17Cl2N3O6S2 and a molecular weight of 566.44 g/mol. Its IUPAC name is N-[3,4-bis[benzenesulfonyl(chloro)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3,4-bis[benzenesulfonyl(chloro)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 118497675 |
| Molecular Formula | C23H17Cl2N3O6S2 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 564.99 |
| IUPAC Name | N-[3,4-bis[benzenesulfonyl(chloro)amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N(Cl)S(=O)(=O)c2ccccc2)c(N(Cl)S(=O)(=O)c2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C23H17Cl2N3O6S2/c24-27(35(30,31)18-8-3-1-4-9-18)20-14-13-17(26-23(29)22-12-7-15-34-22)16-21(20)28(25)36(32,33)19-10-5-2-6-11-19/h1-16H,(H,26,29) |
| InChIKey | QFJVBIFMGJCTHX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|