About 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene
4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene (PubChem CID 118497695) has the molecular formula C21H22N2O5S2
and a molecular weight of 446.55 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene |
| PubChem CID | 118497695 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene |
| SMILES | Cc1ccc(N(c2ccc(CO)cc2N(c2ccc(C)cc2)S(=O)O)S(=O)O)cc1 |
| InChI | InChI=1S/C21H22N2O5S2/c1-15-3-8-18(9-4-15)22(29(25)26)20-12-7-17(14-24)13-21(20)23(30(27)28)19-10-5-16(2)6-11-19/h3-13,24H,14H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | UFFXANIPXNLPHJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene?
The IUPAC name of 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene (CID 118497695) is 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene.
What is the SMILES notation for 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene?
The canonical SMILES for 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene is Cc1ccc(N(c2ccc(CO)cc2N(c2ccc(C)cc2)S(=O)O)S(=O)O)cc1.
What is the InChIKey of 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene?
The InChIKey is UFFXANIPXNLPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O5S2/c1-15-3-8-18(9-4-15)22(29(25)26)20-12-7-17(14-24)13-21(20)23(30(27)28)19-10-5-16(2)6-11-19/h3-13,24H,14H2,1-2H3,(H,25,26)(H,27,28).
What are the key properties of 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene?
4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene has a molecular weight of 446.55 g/mol, XLogP of 4.35, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-1,2-bis(4-methyl-N-sulfinoanilino)benzene is sourced from PubChem (CID 118497695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).