C11H12ClF3N2O2 — CID 118497793
2-chloro-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide (PubChem CID 118497793) has the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.68 g/mol. Its IUPAC name is 2-chloro-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 118497793 |
| Molecular Formula | C11H12ClF3N2O2 |
| Molecular Weight | 296.68 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-chloro-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide |
| SMILES | CC(NC(=O)CCl)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H12ClF3N2O2/c1-7(17-10(18)4-12)9-3-2-8(5-16-9)19-6-11(13,14)15/h2-3,5,7H,4,6H2,1H3,(H,17,18) |
| InChIKey | IORPAINCNLGWOQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|