C9H5F9N2O2 — CID 118498160
2,4-bis(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidine (PubChem CID 118498160) has the molecular formula C9H5F9N2O2 and a molecular weight of 344.13 g/mol. Its IUPAC name is 2,4-bis(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2,4-bis(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 118498160 |
| Molecular Formula | C9H5F9N2O2 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2,4-bis(2,2,2-trifluoroethoxy)-5-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)COc1ncc(C(F)(F)F)c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H5F9N2O2/c10-7(11,12)2-21-5-4(9(16,17)18)1-19-6(20-5)22-3-8(13,14)15/h1H,2-3H2 |
| InChIKey | NWFQLNPMKBHGIZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |