About methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate
methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate (PubChem CID 118498217) has the molecular formula C26H27NO3
and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate |
| PubChem CID | 118498217 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H](c2ccccc2)CN1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO3/c1-29-26(28)17-24-16-22(21-10-6-3-7-11-21)18-27(24)23-12-14-25(15-13-23)30-19-20-8-4-2-5-9-20/h2-15,22,24H,16-19H2,1H3/t22-,24-/m1/s1 |
| InChIKey | JIXGHFXTFVDUGC-ISKFKSNPSA-N |
| XLogP | 5.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate?
The IUPAC name of methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate (CID 118498217) is methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate?
The canonical SMILES for methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate is COC(=O)C[C@H]1C[C@@H](c2ccccc2)CN1c1ccc(OCc2ccccc2)cc1.
What is the InChIKey of methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate?
The InChIKey is JIXGHFXTFVDUGC-ISKFKSNPSA-N. The full InChI is InChI=1S/C26H27NO3/c1-29-26(28)17-24-16-22(21-10-6-3-7-11-21)18-27(24)23-12-14-25(15-13-23)30-19-20-8-4-2-5-9-20/h2-15,22,24H,16-19H2,1H3/t22-,24-/m1/s1.
What are the key properties of methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate?
methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate has a molecular weight of 401.51 g/mol, XLogP of 5.19, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2R,4S)-4-phenyl-1-(4-phenylmethoxyphenyl)pyrrolidin-2-yl]acetate is sourced from PubChem (CID 118498217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).