About (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine
(E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine (PubChem CID 11849822) has the molecular formula C20H25ClN4O2
and a molecular weight of 388.90 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine.
Molecular Properties
| Compound Name | (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine |
| PubChem CID | 11849822 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine |
| SMILES | CO/N=C(\c1ccc(Cl)cc1)C(CN1CCN(c2ccccn2)CC1)OC |
| InChI | InChI=1S/C20H25ClN4O2/c1-26-18(20(23-27-2)16-6-8-17(21)9-7-16)15-24-11-13-25(14-12-24)19-5-3-4-10-22-19/h3-10,18H,11-15H2,1-2H3/b23-20+ |
| InChIKey | QCUYOTOCPIEGQR-BSYVCWPDSA-N |
| XLogP | 2.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine?
The IUPAC name of (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine (CID 11849822) is (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine.
What is the SMILES notation for (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine?
The canonical SMILES for (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine is CO/N=C(\c1ccc(Cl)cc1)C(CN1CCN(c2ccccn2)CC1)OC.
What is the InChIKey of (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine?
The InChIKey is QCUYOTOCPIEGQR-BSYVCWPDSA-N. The full InChI is InChI=1S/C20H25ClN4O2/c1-26-18(20(23-27-2)16-6-8-17(21)9-7-16)15-24-11-13-25(14-12-24)19-5-3-4-10-22-19/h3-10,18H,11-15H2,1-2H3/b23-20+.
What are the key properties of (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine?
(E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine has a molecular weight of 388.90 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(4-chlorophenyl)-N,2-dimethoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine is sourced from PubChem (CID 11849822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).